C21H23B2ClF4N2O5 — CID 91387957
[2-chloro-N-[[2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]-5-(trifluoromethyl)anilino]boronic acid (PubChem CID 91387957) has the molecular formula C21H23B2ClF4N2O5 and a molecular weight of 516.49 g/mol. Its IUPAC name is [2-chloro-N-[[2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]-5-(trifluoromethyl)anilino]boronic acid.
| Compound Name | [2-chloro-N-[[2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]-5-(trifluoromethyl)anilino]boronic acid |
|---|---|
| PubChem CID | 91387957 |
| Molecular Formula | C21H23B2ClF4N2O5 |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | [2-chloro-N-[[2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoyl]-5-(trifluoromethyl)anilino]boronic acid |
| SMILES | Cc1cc(NC(=O)N(B(O)O)c2cc(C(F)(F)F)ccc2Cl)c(F)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H23B2ClF4N2O5/c1-11-8-16(15(25)10-13(11)22-34-19(2,3)20(4,5)35-22)29-18(31)30(23(32)33)17-9-12(21(26,27)28)6-7-14(17)24/h6-10,32-33H,1-5H3,(H,29,31) |
| InChIKey | FGIRTFAZQSDWJO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|