C28H43N3O4 — CID 59234462
(E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2R,4S)-1-methyl-4-phenylpiperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 59234462) has the molecular formula C28H43N3O4 and a molecular weight of 485.67 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2R,4S)-1-methyl-4-phenylpiperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2R,4S)-1-methyl-4-phenylpiperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 59234462 |
| Molecular Formula | C28H43N3O4 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | (E,4S)-4-[[(2S)-3,3-dimethyl-2-[[(2R,4S)-1-methyl-4-phenylpiperidine-2-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)[C@@H](NC(=O)[C@H]1C[C@@H](c2ccccc2)CCN1C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C28H43N3O4/c1-18(2)22(16-19(3)27(34)35)31(8)26(33)24(28(4,5)6)29-25(32)23-17-21(14-15-30(23)7)20-12-10-9-11-13-20/h9-13,16,18,21-24H,14-15,17H2,1-8H3,(H,29,32)(H,34,35)/b19-16+/t21-,22+,23+,24+/m0/s1 |
| InChIKey | KNNXURPSBFYBEK-QLCIFHHJSA-N |
| XLogP | 3.91 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|