C28H43N3O4S — CID 90928807
(4S)-4-[[(2S)-3,3-dimethyl-2-[[(2S,4R)-3,5,5-trimethyl-2-phenyl-1,3-thiazolidine-4-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 90928807) has the molecular formula C28H43N3O4S and a molecular weight of 517.74 g/mol. Its IUPAC name is (4S)-4-[[(2S)-3,3-dimethyl-2-[[(2S,4R)-3,5,5-trimethyl-2-phenyl-1,3-thiazolidine-4-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | (4S)-4-[[(2S)-3,3-dimethyl-2-[[(2S,4R)-3,5,5-trimethyl-2-phenyl-1,3-thiazolidine-4-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 90928807 |
| Molecular Formula | C28H43N3O4S |
| Molecular Weight | 517.74 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | (4S)-4-[[(2S)-3,3-dimethyl-2-[[(2S,4R)-3,5,5-trimethyl-2-phenyl-1,3-thiazolidine-4-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | CC(=C[C@H](C(C)C)N(C)C(=O)[C@@H](NC(=O)[C@H]1N(C)[C@H](c2ccccc2)SC1(C)C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C28H43N3O4S/c1-17(2)20(16-18(3)26(34)35)30(9)24(33)21(27(4,5)6)29-23(32)22-28(7,8)36-25(31(22)10)19-14-12-11-13-15-19/h11-17,20-22,25H,1-10H3,(H,29,32)(H,34,35)/t20-,21-,22-,25+/m1/s1 |
| InChIKey | WRUGBWTUUNHBSS-XAISMOLKSA-N |
| XLogP | 4.56 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.74 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|