C30H47N3O4S — CID 147059592
ethyl (E,4S)-4-[[3,3-dimethyl-2-[[(2R,4S)-3,5,5-trimethyl-2-phenyl-1,3-thiazolidine-4-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 147059592) has the molecular formula C30H47N3O4S and a molecular weight of 545.79 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[3,3-dimethyl-2-[[(2R,4S)-3,5,5-trimethyl-2-phenyl-1,3-thiazolidine-4-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[3,3-dimethyl-2-[[(2R,4S)-3,5,5-trimethyl-2-phenyl-1,3-thiazolidine-4-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 147059592 |
| Molecular Formula | C30H47N3O4S |
| Molecular Weight | 545.79 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | ethyl (E,4S)-4-[[3,3-dimethyl-2-[[(2R,4S)-3,5,5-trimethyl-2-phenyl-1,3-thiazolidine-4-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)C(NC(=O)[C@@H]1N(C)[C@@H](c2ccccc2)SC1(C)C)C(C)(C)C |
| InChI | InChI=1S/C30H47N3O4S/c1-12-37-28(36)20(4)18-22(19(2)3)32(10)26(35)23(29(5,6)7)31-25(34)24-30(8,9)38-27(33(24)11)21-16-14-13-15-17-21/h13-19,22-24,27H,12H2,1-11H3,(H,31,34)/b20-18+/t22-,23?,24+,27-/m1/s1 |
| InChIKey | BCXJYVDEXHTFHV-OMYYYGPFSA-N |
| XLogP | 5.03 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.79 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|