C30H49N3O4 — CID 163921958
ethyl (E,4S)-4-[[2-[[hydroxy-[(2S)-1-methyl-4-phenylpiperidin-2-yl]methyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 163921958) has the molecular formula C30H49N3O4 and a molecular weight of 515.74 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[2-[[hydroxy-[(2S)-1-methyl-4-phenylpiperidin-2-yl]methyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[2-[[hydroxy-[(2S)-1-methyl-4-phenylpiperidin-2-yl]methyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 163921958 |
| Molecular Formula | C30H49N3O4 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.37 |
| IUPAC Name | ethyl (E,4S)-4-[[2-[[hydroxy-[(2S)-1-methyl-4-phenylpiperidin-2-yl]methyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)C(NC(O)C1CC(c2ccccc2)CCN1C)C(C)(C)C |
| InChI | InChI=1S/C30H49N3O4/c1-10-37-29(36)21(4)18-24(20(2)3)33(9)28(35)26(30(5,6)7)31-27(34)25-19-23(16-17-32(25)8)22-14-12-11-13-15-22/h11-15,18,20,23-27,31,34H,10,16-17,19H2,1-9H3/b21-18+/t23?,24-,25?,26?,27?/m1/s1 |
| InChIKey | RBDYOVNXKOPKLY-DHSSGWGDSA-N |
| XLogP | 4.18 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|