C22H39N3O4S — CID 90694669
(4S)-4-[[(2S)-3,3-dimethyl-2-[[(4R)-3,5,5-trimethyl-1,3-thiazolidine-4-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 90694669) has the molecular formula C22H39N3O4S and a molecular weight of 441.64 g/mol. Its IUPAC name is (4S)-4-[[(2S)-3,3-dimethyl-2-[[(4R)-3,5,5-trimethyl-1,3-thiazolidine-4-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | (4S)-4-[[(2S)-3,3-dimethyl-2-[[(4R)-3,5,5-trimethyl-1,3-thiazolidine-4-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 90694669 |
| Molecular Formula | C22H39N3O4S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | (4S)-4-[[(2S)-3,3-dimethyl-2-[[(4R)-3,5,5-trimethyl-1,3-thiazolidine-4-carbonyl]amino]butanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | CC(=C[C@H](C(C)C)N(C)C(=O)[C@@H](NC(=O)[C@H]1N(C)CSC1(C)C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C22H39N3O4S/c1-13(2)15(11-14(3)20(28)29)25(10)19(27)16(21(4,5)6)23-18(26)17-22(7,8)30-12-24(17)9/h11,13,15-17H,12H2,1-10H3,(H,23,26)(H,28,29)/t15-,16-,17-/m1/s1 |
| InChIKey | LSEMDHQGHPQJJU-BRWVUGGUSA-N |
| XLogP | 2.81 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|