C16H10Br3ClO — CID 59235322
(5-bromo-2-chlorophenyl)-[4-(2,2-dibromo-1-deuteriocyclopropyl)phenyl]methanone (PubChem CID 59235322) has the molecular formula C16H10Br3ClO and a molecular weight of 494.43 g/mol. Its IUPAC name is (5-bromo-2-chlorophenyl)-[4-(2,2-dibromo-1-deuteriocyclopropyl)phenyl]methanone.
| Compound Name | (5-bromo-2-chlorophenyl)-[4-(2,2-dibromo-1-deuteriocyclopropyl)phenyl]methanone |
|---|---|
| PubChem CID | 59235322 |
| Molecular Formula | C16H10Br3ClO |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 490.80 |
| IUPAC Name | (5-bromo-2-chlorophenyl)-[4-(2,2-dibromo-1-deuteriocyclopropyl)phenyl]methanone |
| SMILES | [2H]C1(c2ccc(C(=O)c3cc(Br)ccc3Cl)cc2)CC1(Br)Br |
| InChI | InChI=1S/C16H10Br3ClO/c17-11-5-6-14(20)12(7-11)15(21)10-3-1-9(2-4-10)13-8-16(13,18)19/h1-7,13H,8H2/i13D |
| InChIKey | YNAYQAWGNMHXPM-YSOHJTORSA-N |
| XLogP | 6.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|