C24H28N4O6S2 — CID 59236978
1-N'-(2,3-dimethoxybenzenecarbothioyl)-3-N'-(2-formyl-3-methoxybenzenecarbothioyl)-1-N',3-N',2-trimethylpropanedihydrazide (PubChem CID 59236978) has the molecular formula C24H28N4O6S2 and a molecular weight of 532.64 g/mol. Its IUPAC name is 1-N'-(2,3-dimethoxybenzenecarbothioyl)-3-N'-(2-formyl-3-methoxybenzenecarbothioyl)-1-N',3-N',2-trimethylpropanedihydrazide.
| Compound Name | 1-N'-(2,3-dimethoxybenzenecarbothioyl)-3-N'-(2-formyl-3-methoxybenzenecarbothioyl)-1-N',3-N',2-trimethylpropanedihydrazide |
|---|---|
| PubChem CID | 59236978 |
| Molecular Formula | C24H28N4O6S2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 1-N'-(2,3-dimethoxybenzenecarbothioyl)-3-N'-(2-formyl-3-methoxybenzenecarbothioyl)-1-N',3-N',2-trimethylpropanedihydrazide |
| SMILES | COc1cccc(C(=S)N(C)NC(=O)C(C)C(=O)NN(C)C(=S)c2cccc(OC)c2OC)c1C=O |
| InChI | InChI=1S/C24H28N4O6S2/c1-14(21(30)25-27(2)23(35)15-9-7-11-18(32-4)17(15)13-29)22(31)26-28(3)24(36)16-10-8-12-19(33-5)20(16)34-6/h7-14H,1-6H3,(H,25,30)(H,26,31) |
| InChIKey | SZYRIFKMKHEZPW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|