C26H17NO6S — CID 59241481
methyl 3-(4-hydroxy-2,5-dioxo-6-phenylpyrano[3,2-c]quinolin-3-yl)sulfanylbenzoate (PubChem CID 59241481) has the molecular formula C26H17NO6S and a molecular weight of 471.49 g/mol. Its IUPAC name is methyl 3-(4-hydroxy-2,5-dioxo-6-phenylpyrano[3,2-c]quinolin-3-yl)sulfanylbenzoate.
| Compound Name | methyl 3-(4-hydroxy-2,5-dioxo-6-phenylpyrano[3,2-c]quinolin-3-yl)sulfanylbenzoate |
|---|---|
| PubChem CID | 59241481 |
| Molecular Formula | C26H17NO6S |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | methyl 3-(4-hydroxy-2,5-dioxo-6-phenylpyrano[3,2-c]quinolin-3-yl)sulfanylbenzoate |
| SMILES | COC(=O)c1cccc(Sc2c(O)c3c(=O)n(-c4ccccc4)c4ccccc4c3oc2=O)c1 |
| InChI | InChI=1S/C26H17NO6S/c1-32-25(30)15-8-7-11-17(14-15)34-23-21(28)20-22(33-26(23)31)18-12-5-6-13-19(18)27(24(20)29)16-9-3-2-4-10-16/h2-14,28H,1H3 |
| InChIKey | PMOMKFLYRMBYPG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|