C27H19NO7S — CID 59241024
methyl 2-[3-(4-hydroxy-2,5-dioxo-6-phenylpyrano[3,2-c]quinolin-3-yl)sulfanylphenoxy]acetate (PubChem CID 59241024) has the molecular formula C27H19NO7S and a molecular weight of 501.52 g/mol. Its IUPAC name is methyl 2-[3-(4-hydroxy-2,5-dioxo-6-phenylpyrano[3,2-c]quinolin-3-yl)sulfanylphenoxy]acetate.
| Compound Name | methyl 2-[3-(4-hydroxy-2,5-dioxo-6-phenylpyrano[3,2-c]quinolin-3-yl)sulfanylphenoxy]acetate |
|---|---|
| PubChem CID | 59241024 |
| Molecular Formula | C27H19NO7S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | methyl 2-[3-(4-hydroxy-2,5-dioxo-6-phenylpyrano[3,2-c]quinolin-3-yl)sulfanylphenoxy]acetate |
| SMILES | COC(=O)COc1cccc(Sc2c(O)c3c(=O)n(-c4ccccc4)c4ccccc4c3oc2=O)c1 |
| InChI | InChI=1S/C27H19NO7S/c1-33-21(29)15-34-17-10-7-11-18(14-17)36-25-23(30)22-24(35-27(25)32)19-12-5-6-13-20(19)28(26(22)31)16-8-3-2-4-9-16/h2-14,30H,15H2,1H3 |
| InChIKey | VHOFSCBCSCFSMJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|