C27H21NO6S — CID 59241631
4-hydroxy-6-[(2-methoxyphenyl)methyl]-3-(3-methoxyphenyl)sulfanylpyrano[3,2-c]quinoline-2,5-dione (PubChem CID 59241631) has the molecular formula C27H21NO6S and a molecular weight of 487.53 g/mol. Its IUPAC name is 4-hydroxy-6-[(2-methoxyphenyl)methyl]-3-(3-methoxyphenyl)sulfanylpyrano[3,2-c]quinoline-2,5-dione.
| Compound Name | 4-hydroxy-6-[(2-methoxyphenyl)methyl]-3-(3-methoxyphenyl)sulfanylpyrano[3,2-c]quinoline-2,5-dione |
|---|---|
| PubChem CID | 59241631 |
| Molecular Formula | C27H21NO6S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 4-hydroxy-6-[(2-methoxyphenyl)methyl]-3-(3-methoxyphenyl)sulfanylpyrano[3,2-c]quinoline-2,5-dione |
| SMILES | COc1cccc(Sc2c(O)c3c(=O)n(Cc4ccccc4OC)c4ccccc4c3oc2=O)c1 |
| InChI | InChI=1S/C27H21NO6S/c1-32-17-9-7-10-18(14-17)35-25-23(29)22-24(34-27(25)31)19-11-4-5-12-20(19)28(26(22)30)15-16-8-3-6-13-21(16)33-2/h3-14,29H,15H2,1-2H3 |
| InChIKey | UZFZZECSGMMQAJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|