C26H19NO5S — CID 59241392
4-hydroxy-6-[(4-methoxyphenyl)methyl]-3-phenylsulfanylpyrano[3,2-c]quinoline-2,5-dione (PubChem CID 59241392) has the molecular formula C26H19NO5S and a molecular weight of 457.51 g/mol. Its IUPAC name is 4-hydroxy-6-[(4-methoxyphenyl)methyl]-3-phenylsulfanylpyrano[3,2-c]quinoline-2,5-dione.
| Compound Name | 4-hydroxy-6-[(4-methoxyphenyl)methyl]-3-phenylsulfanylpyrano[3,2-c]quinoline-2,5-dione |
|---|---|
| PubChem CID | 59241392 |
| Molecular Formula | C26H19NO5S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 4-hydroxy-6-[(4-methoxyphenyl)methyl]-3-phenylsulfanylpyrano[3,2-c]quinoline-2,5-dione |
| SMILES | COc1ccc(Cn2c(=O)c3c(O)c(Sc4ccccc4)c(=O)oc3c3ccccc32)cc1 |
| InChI | InChI=1S/C26H19NO5S/c1-31-17-13-11-16(12-14-17)15-27-20-10-6-5-9-19(20)23-21(25(27)29)22(28)24(26(30)32-23)33-18-7-3-2-4-8-18/h2-14,28H,15H2,1H3 |
| InChIKey | GUIUFGPSFADMQX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|