C26H16N2O5S — CID 59240986
3-(1,3-benzoxazol-2-ylsulfanyl)-6-benzyl-4-hydroxypyrano[3,2-c]quinoline-2,5-dione (PubChem CID 59240986) has the molecular formula C26H16N2O5S and a molecular weight of 468.49 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-ylsulfanyl)-6-benzyl-4-hydroxypyrano[3,2-c]quinoline-2,5-dione.
| Compound Name | 3-(1,3-benzoxazol-2-ylsulfanyl)-6-benzyl-4-hydroxypyrano[3,2-c]quinoline-2,5-dione |
|---|---|
| PubChem CID | 59240986 |
| Molecular Formula | C26H16N2O5S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 3-(1,3-benzoxazol-2-ylsulfanyl)-6-benzyl-4-hydroxypyrano[3,2-c]quinoline-2,5-dione |
| SMILES | O=c1oc2c(c(O)c1Sc1nc3ccccc3o1)c(=O)n(Cc1ccccc1)c1ccccc21 |
| InChI | InChI=1S/C26H16N2O5S/c29-21-20-22(33-25(31)23(21)34-26-27-17-11-5-7-13-19(17)32-26)16-10-4-6-12-18(16)28(24(20)30)14-15-8-2-1-3-9-15/h1-13,29H,14H2 |
| InChIKey | SZBTUHZEFMSFAB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|