C26H16BrNO6S — CID 59241210
9-benzyl-5-(2-bromophenyl)sulfanyl-6-hydroxy-3,13,15-trioxa-9-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),5,10,12(16)-pentaene-4,8-dione (PubChem CID 59241210) has the molecular formula C26H16BrNO6S and a molecular weight of 550.39 g/mol. Its IUPAC name is 9-benzyl-5-(2-bromophenyl)sulfanyl-6-hydroxy-3,13,15-trioxa-9-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),5,10,12(16)-pentaene-4,8-dione.
| Compound Name | 9-benzyl-5-(2-bromophenyl)sulfanyl-6-hydroxy-3,13,15-trioxa-9-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),5,10,12(16)-pentaene-4,8-dione |
|---|---|
| PubChem CID | 59241210 |
| Molecular Formula | C26H16BrNO6S |
| Molecular Weight | 550.39 g/mol |
| Exact Mass | 548.99 |
| IUPAC Name | 9-benzyl-5-(2-bromophenyl)sulfanyl-6-hydroxy-3,13,15-trioxa-9-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),5,10,12(16)-pentaene-4,8-dione |
| SMILES | O=c1oc2c(c(O)c1Sc1ccccc1Br)c(=O)n(Cc1ccccc1)c1cc3c(cc21)OCO3 |
| InChI | InChI=1S/C26H16BrNO6S/c27-16-8-4-5-9-20(16)35-24-22(29)21-23(34-26(24)31)15-10-18-19(33-13-32-18)11-17(15)28(25(21)30)12-14-6-2-1-3-7-14/h1-11,29H,12-13H2 |
| InChIKey | XPYJKSLYSCZZSF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|