C26H17F2NO6S2 — CID 59241120
6-[(4-fluorophenyl)methyl]-3-(2-fluorophenyl)sulfanyl-4-hydroxy-8-methylsulfonylpyrano[3,2-c]quinoline-2,5-dione (PubChem CID 59241120) has the molecular formula C26H17F2NO6S2 and a molecular weight of 541.55 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-3-(2-fluorophenyl)sulfanyl-4-hydroxy-8-methylsulfonylpyrano[3,2-c]quinoline-2,5-dione.
| Compound Name | 6-[(4-fluorophenyl)methyl]-3-(2-fluorophenyl)sulfanyl-4-hydroxy-8-methylsulfonylpyrano[3,2-c]quinoline-2,5-dione |
|---|---|
| PubChem CID | 59241120 |
| Molecular Formula | C26H17F2NO6S2 |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-3-(2-fluorophenyl)sulfanyl-4-hydroxy-8-methylsulfonylpyrano[3,2-c]quinoline-2,5-dione |
| SMILES | CS(=O)(=O)c1ccc2c3oc(=O)c(Sc4ccccc4F)c(O)c3c(=O)n(Cc3ccc(F)cc3)c2c1 |
| InChI | InChI=1S/C26H17F2NO6S2/c1-37(33,34)16-10-11-17-19(12-16)29(13-14-6-8-15(27)9-7-14)25(31)21-22(30)24(26(32)35-23(17)21)36-20-5-3-2-4-18(20)28/h2-12,30H,13H2,1H3 |
| InChIKey | MEGRRHYXBBWUQP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|