C26H19FN2O5S — CID 59241256
6-[(4-fluorophenyl)methyl]-4-hydroxy-3-(4-methoxyphenyl)sulfanyl-8-methylpyrano[3,2-c][1,8]naphthyridine-2,5-dione (PubChem CID 59241256) has the molecular formula C26H19FN2O5S and a molecular weight of 490.51 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-4-hydroxy-3-(4-methoxyphenyl)sulfanyl-8-methylpyrano[3,2-c][1,8]naphthyridine-2,5-dione.
| Compound Name | 6-[(4-fluorophenyl)methyl]-4-hydroxy-3-(4-methoxyphenyl)sulfanyl-8-methylpyrano[3,2-c][1,8]naphthyridine-2,5-dione |
|---|---|
| PubChem CID | 59241256 |
| Molecular Formula | C26H19FN2O5S |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-4-hydroxy-3-(4-methoxyphenyl)sulfanyl-8-methylpyrano[3,2-c][1,8]naphthyridine-2,5-dione |
| SMILES | COc1ccc(Sc2c(O)c3c(=O)n(Cc4ccc(F)cc4)c4nc(C)ccc4c3oc2=O)cc1 |
| InChI | InChI=1S/C26H19FN2O5S/c1-14-3-12-19-22-20(25(31)29(24(19)28-14)13-15-4-6-16(27)7-5-15)21(30)23(26(32)34-22)35-18-10-8-17(33-2)9-11-18/h3-12,30H,13H2,1-2H3 |
| InChIKey | ZUMFNXPHVKAIGU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|