C25H17FIN3O3S — CID 163695673
6-[(4-fluorophenyl)methyl]-4-hydroxy-5-imino-3-(3-iodophenyl)sulfanyl-9-methylpyrano[3,2-c][1,8]naphthyridin-2-one (PubChem CID 163695673) has the molecular formula C25H17FIN3O3S and a molecular weight of 585.40 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-4-hydroxy-5-imino-3-(3-iodophenyl)sulfanyl-9-methylpyrano[3,2-c][1,8]naphthyridin-2-one.
| Compound Name | 6-[(4-fluorophenyl)methyl]-4-hydroxy-5-imino-3-(3-iodophenyl)sulfanyl-9-methylpyrano[3,2-c][1,8]naphthyridin-2-one |
|---|---|
| PubChem CID | 163695673 |
| Molecular Formula | C25H17FIN3O3S |
| Molecular Weight | 585.40 g/mol |
| Exact Mass | 585.00 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-4-hydroxy-5-imino-3-(3-iodophenyl)sulfanyl-9-methylpyrano[3,2-c][1,8]naphthyridin-2-one |
| SMILES | [H]/N=c1\c2c(O)c(Sc3cccc(I)c3)c(=O)oc2c2cc(C)cnc2n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H17FIN3O3S/c1-13-9-18-21-19(20(31)22(25(32)33-21)34-17-4-2-3-16(27)10-17)23(28)30(24(18)29-11-13)12-14-5-7-15(26)8-6-14/h2-11,28,31H,12H2,1H3/b28-23+ |
| InChIKey | JWSWBZLZZMXBFG-WEMUOSSPSA-N |
| XLogP | 5.58 |
| TPSA | 92.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|