C26H15F4NO4S — CID 59241713
6-[(3-fluorophenyl)methyl]-4-hydroxy-3-[4-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-c]quinoline-2,5-dione (PubChem CID 59241713) has the molecular formula C26H15F4NO4S and a molecular weight of 513.47 g/mol. Its IUPAC name is 6-[(3-fluorophenyl)methyl]-4-hydroxy-3-[4-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-c]quinoline-2,5-dione.
| Compound Name | 6-[(3-fluorophenyl)methyl]-4-hydroxy-3-[4-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-c]quinoline-2,5-dione |
|---|---|
| PubChem CID | 59241713 |
| Molecular Formula | C26H15F4NO4S |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | 6-[(3-fluorophenyl)methyl]-4-hydroxy-3-[4-(trifluoromethyl)phenyl]sulfanylpyrano[3,2-c]quinoline-2,5-dione |
| SMILES | O=c1oc2c(c(O)c1Sc1ccc(C(F)(F)F)cc1)c(=O)n(Cc1cccc(F)c1)c1ccccc21 |
| InChI | InChI=1S/C26H15F4NO4S/c27-16-5-3-4-14(12-16)13-31-19-7-2-1-6-18(19)22-20(24(31)33)21(32)23(25(34)35-22)36-17-10-8-15(9-11-17)26(28,29)30/h1-12,32H,13H2 |
| InChIKey | FVJYXUJQAUEUES-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|