C25H15BrFNO4S — CID 59240930
3-(2-bromophenyl)sulfanyl-6-[(3-fluorophenyl)methyl]-4-hydroxypyrano[3,2-c]quinoline-2,5-dione (PubChem CID 59240930) has the molecular formula C25H15BrFNO4S and a molecular weight of 524.37 g/mol. Its IUPAC name is 3-(2-bromophenyl)sulfanyl-6-[(3-fluorophenyl)methyl]-4-hydroxypyrano[3,2-c]quinoline-2,5-dione.
| Compound Name | 3-(2-bromophenyl)sulfanyl-6-[(3-fluorophenyl)methyl]-4-hydroxypyrano[3,2-c]quinoline-2,5-dione |
|---|---|
| PubChem CID | 59240930 |
| Molecular Formula | C25H15BrFNO4S |
| Molecular Weight | 524.37 g/mol |
| Exact Mass | 522.99 |
| IUPAC Name | 3-(2-bromophenyl)sulfanyl-6-[(3-fluorophenyl)methyl]-4-hydroxypyrano[3,2-c]quinoline-2,5-dione |
| SMILES | O=c1oc2c(c(O)c1Sc1ccccc1Br)c(=O)n(Cc1cccc(F)c1)c1ccccc21 |
| InChI | InChI=1S/C25H15BrFNO4S/c26-17-9-2-4-11-19(17)33-23-21(29)20-22(32-25(23)31)16-8-1-3-10-18(16)28(24(20)30)13-14-6-5-7-15(27)12-14/h1-12,29H,13H2 |
| InChIKey | KJPHRKDRSJGTIT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.37 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|