C22H14F3NO4S — CID 59241612
6-hydroxy-10-methyl-5-[3-(trifluoromethyl)phenyl]sulfanyl-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaene-4,8-dione (PubChem CID 59241612) has the molecular formula C22H14F3NO4S and a molecular weight of 445.42 g/mol. Its IUPAC name is 6-hydroxy-10-methyl-5-[3-(trifluoromethyl)phenyl]sulfanyl-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaene-4,8-dione.
| Compound Name | 6-hydroxy-10-methyl-5-[3-(trifluoromethyl)phenyl]sulfanyl-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaene-4,8-dione |
|---|---|
| PubChem CID | 59241612 |
| Molecular Formula | C22H14F3NO4S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 6-hydroxy-10-methyl-5-[3-(trifluoromethyl)phenyl]sulfanyl-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaene-4,8-dione |
| SMILES | CC1Cc2cccc3c4oc(=O)c(Sc5cccc(C(F)(F)F)c5)c(O)c4c(=O)n1c23 |
| InChI | InChI=1S/C22H14F3NO4S/c1-10-8-11-4-2-7-14-16(11)26(10)20(28)15-17(27)19(21(29)30-18(14)15)31-13-6-3-5-12(9-13)22(23,24)25/h2-7,9-10,27H,8H2,1H3 |
| InChIKey | RKARKHJYNUMIGE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|