C29H30F8O — CID 59247597
5-[4-[1,1-difluoro-3-(4-pentylcyclohexyl)propoxy]-2-fluorophenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)benzene (PubChem CID 59247597) has the molecular formula C29H30F8O and a molecular weight of 546.54 g/mol. Its IUPAC name is 5-[4-[1,1-difluoro-3-(4-pentylcyclohexyl)propoxy]-2-fluorophenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)benzene.
| Compound Name | 5-[4-[1,1-difluoro-3-(4-pentylcyclohexyl)propoxy]-2-fluorophenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)benzene |
|---|---|
| PubChem CID | 59247597 |
| Molecular Formula | C29H30F8O |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 5-[4-[1,1-difluoro-3-(4-pentylcyclohexyl)propoxy]-2-fluorophenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)benzene |
| SMILES | CCCCCC1CCC(CCC(F)(F)Oc2ccc(-c3cc(F)c(C#CC(F)(F)F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C29H30F8O/c1-2-3-4-5-19-6-8-20(9-7-19)12-15-29(36,37)38-22-10-11-23(27(32)18-22)21-16-25(30)24(26(31)17-21)13-14-28(33,34)35/h10-11,16-20H,2-9,12,15H2,1H3 |
| InChIKey | IMOUXZLAARZRJA-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|