C17H20N2O — CID 59248871
5-isocyano-2-(7-phenylheptan-2-yl)-1,3-oxazole (PubChem CID 59248871) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-isocyano-2-(7-phenylheptan-2-yl)-1,3-oxazole.
| Compound Name | 5-isocyano-2-(7-phenylheptan-2-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 59248871 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 5-isocyano-2-(7-phenylheptan-2-yl)-1,3-oxazole |
| SMILES | [C-]#[N+]c1cnc(C(C)CCCCCc2ccccc2)o1 |
| InChI | InChI=1S/C17H20N2O/c1-14(17-19-13-16(18-2)20-17)9-5-3-6-10-15-11-7-4-8-12-15/h4,7-8,11-14H,3,5-6,9-10H2,1H3 |
| InChIKey | ITZYDJUXNVQGPJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 30.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|