About 4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine
4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine (PubChem CID 59252287) has the molecular formula C20H30N4O
and a molecular weight of 342.49 g/mol. Its IUPAC name is 4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine |
| PubChem CID | 59252287 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine |
| SMILES | Cc1ccc2onc(N3CCN(CCC4CCC(N)CC4)CC3)c2c1 |
| InChI | InChI=1S/C20H30N4O/c1-15-2-7-19-18(14-15)20(22-25-19)24-12-10-23(11-13-24)9-8-16-3-5-17(21)6-4-16/h2,7,14,16-17H,3-6,8-13,21H2,1H3 |
| InChIKey | AREGRTNWKGGJJO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine?
The IUPAC name of 4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine (CID 59252287) is 4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine.
What is the SMILES notation for 4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine?
The canonical SMILES for 4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine is Cc1ccc2onc(N3CCN(CCC4CCC(N)CC4)CC3)c2c1.
What is the InChIKey of 4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine?
The InChIKey is AREGRTNWKGGJJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N4O/c1-15-2-7-19-18(14-15)20(22-25-19)24-12-10-23(11-13-24)9-8-16-3-5-17(21)6-4-16/h2,7,14,16-17H,3-6,8-13,21H2,1H3.
What are the key properties of 4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine?
4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine has a molecular weight of 342.49 g/mol, XLogP of 3.17, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexan-1-amine is sourced from PubChem (CID 59252287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).