C16H18N4Pt — CID 59254130
platinum(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)cyclohexyl]methanimine (PubChem CID 59254130) has the molecular formula C16H18N4Pt and a molecular weight of 461.43 g/mol. Its IUPAC name is platinum(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)cyclohexyl]methanimine.
| Compound Name | platinum(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)cyclohexyl]methanimine |
|---|---|
| PubChem CID | 59254130 |
| Molecular Formula | C16H18N4Pt |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | platinum(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)cyclohexyl]methanimine |
| SMILES | C(=N/C1CCCCC1/N=C/c1ccc[n-]1)\c1ccc[n-]1.[Pt+2] |
| InChI | InChI=1S/C16H18N4.Pt/c1-2-8-16(20-12-14-6-4-10-18-14)15(7-1)19-11-13-5-3-9-17-13;/h3-6,9-12,15-16H,1-2,7-8H2;/q-2;+2/b19-11+,20-12+; |
| InChIKey | DIPORHMKEPJSRW-BYCVLTJGSA-N |
| XLogP | 2.45 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|