C33H49N4O4+ — CID 59254220
3-[[4-[3-[(4-benzoylbenzoyl)amino]propylcarbamoyl]-2,2,4-trimethylhexanoyl]amino]propyl-trimethylazanium (PubChem CID 59254220) has the molecular formula C33H49N4O4+ and a molecular weight of 565.78 g/mol. Its IUPAC name is 3-[[4-[3-[(4-benzoylbenzoyl)amino]propylcarbamoyl]-2,2,4-trimethylhexanoyl]amino]propyl-trimethylazanium.
| Compound Name | 3-[[4-[3-[(4-benzoylbenzoyl)amino]propylcarbamoyl]-2,2,4-trimethylhexanoyl]amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 59254220 |
| Molecular Formula | C33H49N4O4+ |
| Molecular Weight | 565.78 g/mol |
| Exact Mass | 565.37 |
| IUPAC Name | 3-[[4-[3-[(4-benzoylbenzoyl)amino]propylcarbamoyl]-2,2,4-trimethylhexanoyl]amino]propyl-trimethylazanium |
| SMILES | CCC(C)(CC(C)(C)C(=O)NCCC[N+](C)(C)C)C(=O)NCCCNC(=O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H48N4O4/c1-8-33(4,24-32(2,3)30(40)35-22-13-23-37(5,6)7)31(41)36-21-12-20-34-29(39)27-18-16-26(17-19-27)28(38)25-14-10-9-11-15-25/h9-11,14-19H,8,12-13,20-24H2,1-7H3,(H2-,34,35,36,39,40,41)/p+1 |
| InChIKey | LDVRIBLLAMGTSY-UHFFFAOYSA-O |
| XLogP | 4.20 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.78 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|