C21H36O3 — CID 59263591
(2S,3E,5Z,7E,9E,11R,12S)-2-pentylhexadeca-3,5,7,9-tetraene-1,11,12-triol (PubChem CID 59263591) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is (2S,3E,5Z,7E,9E,11R,12S)-2-pentylhexadeca-3,5,7,9-tetraene-1,11,12-triol.
| Compound Name | (2S,3E,5Z,7E,9E,11R,12S)-2-pentylhexadeca-3,5,7,9-tetraene-1,11,12-triol |
|---|---|
| PubChem CID | 59263591 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (2S,3E,5Z,7E,9E,11R,12S)-2-pentylhexadeca-3,5,7,9-tetraene-1,11,12-triol |
| SMILES | CCCCC[C@@H](/C=C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)CCCC)CO |
| InChI | InChI=1S/C21H36O3/c1-3-5-11-14-19(18-22)15-12-9-7-8-10-13-17-21(24)20(23)16-6-4-2/h7-10,12-13,15,17,19-24H,3-6,11,14,16,18H2,1-2H3/b9-7-,10-8+,15-12+,17-13+/t19-,20-,21+/m0/s1 |
| InChIKey | ZZWCFDWWVDWSBG-GITFFUTCSA-N |
| XLogP | 4.31 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|