C19H23N3O6S2 — CID 59270196
3-[[2,3,4-trimethoxy-6-[(3-nitro-2-pyridinyl)disulfanyl]phenyl]methylamino]butan-2-one (PubChem CID 59270196) has the molecular formula C19H23N3O6S2 and a molecular weight of 453.54 g/mol. Its IUPAC name is 3-[[2,3,4-trimethoxy-6-[(3-nitro-2-pyridinyl)disulfanyl]phenyl]methylamino]butan-2-one.
| Compound Name | 3-[[2,3,4-trimethoxy-6-[(3-nitro-2-pyridinyl)disulfanyl]phenyl]methylamino]butan-2-one |
|---|---|
| PubChem CID | 59270196 |
| Molecular Formula | C19H23N3O6S2 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 3-[[2,3,4-trimethoxy-6-[(3-nitro-2-pyridinyl)disulfanyl]phenyl]methylamino]butan-2-one |
| SMILES | COc1cc(SSc2ncccc2[N+](=O)[O-])c(CNC(C)C(C)=O)c(OC)c1OC |
| InChI | InChI=1S/C19H23N3O6S2/c1-11(12(2)23)21-10-13-16(9-15(26-3)18(28-5)17(13)27-4)29-30-19-14(22(24)25)7-6-8-20-19/h6-9,11,21H,10H2,1-5H3 |
| InChIKey | ITJDAQICCSKVIK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|