C18H25N3O4S2 — CID 91182715
1-[4,5-dimethoxy-2-[(3-nitro-2-pyridinyl)disulfanyl]phenyl]-N-methylmethanamine;propane (PubChem CID 91182715) has the molecular formula C18H25N3O4S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-[4,5-dimethoxy-2-[(3-nitro-2-pyridinyl)disulfanyl]phenyl]-N-methylmethanamine;propane.
| Compound Name | 1-[4,5-dimethoxy-2-[(3-nitro-2-pyridinyl)disulfanyl]phenyl]-N-methylmethanamine;propane |
|---|---|
| PubChem CID | 91182715 |
| Molecular Formula | C18H25N3O4S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-[4,5-dimethoxy-2-[(3-nitro-2-pyridinyl)disulfanyl]phenyl]-N-methylmethanamine;propane |
| SMILES | CCC.CNCc1cc(OC)c(OC)cc1SSc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N3O4S2.C3H8/c1-16-9-10-7-12(21-2)13(22-3)8-14(10)23-24-15-11(18(19)20)5-4-6-17-15;1-3-2/h4-8,16H,9H2,1-3H3;3H2,1-2H3 |
| InChIKey | XNNKVAJMEIOURC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|