C28H47O3- — CID 59271320
(E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)tridec-6-enoate (PubChem CID 59271320) has the molecular formula C28H47O3- and a molecular weight of 431.68 g/mol. Its IUPAC name is (E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)tridec-6-enoate.
| Compound Name | (E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)tridec-6-enoate |
|---|---|
| PubChem CID | 59271320 |
| Molecular Formula | C28H47O3- |
| Molecular Weight | 431.68 g/mol |
| Exact Mass | 431.35 |
| IUPAC Name | (E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)tridec-6-enoate |
| SMILES | C/C(=C\CCC(C)CCCC1(C)CCC2=CCC(C)C(C)C2O1)CCCC(C)C(=O)[O-] |
| InChI | InChI=1S/C28H48O3/c1-20(12-8-14-23(4)27(29)30)10-7-11-21(2)13-9-18-28(6)19-17-25-16-15-22(3)24(5)26(25)31-28/h10,16,21-24,26H,7-9,11-15,17-19H2,1-6H3,(H,29,30)/p-1/b20-10+ |
| InChIKey | SKJQZKQCMACUAT-KEBDBYFISA-M |
| XLogP | 6.62 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|