C32H49O3- — CID 59271423
(5E,9E)-13-(8a-butyl-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)-2,6,10-trimethyltrideca-5,9-dienoate (PubChem CID 59271423) has the molecular formula C32H49O3- and a molecular weight of 481.74 g/mol. Its IUPAC name is (5E,9E)-13-(8a-butyl-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)-2,6,10-trimethyltrideca-5,9-dienoate.
| Compound Name | (5E,9E)-13-(8a-butyl-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)-2,6,10-trimethyltrideca-5,9-dienoate |
|---|---|
| PubChem CID | 59271423 |
| Molecular Formula | C32H49O3- |
| Molecular Weight | 481.74 g/mol |
| Exact Mass | 481.37 |
| IUPAC Name | (5E,9E)-13-(8a-butyl-2,7,8-trimethyl-3,4-dihydrochromen-2-yl)-2,6,10-trimethyltrideca-5,9-dienoate |
| SMILES | CCCCC12OC(C)(CCC/C(C)=C/CC/C(C)=C/CCC(C)C(=O)[O-])CCC1=C=CC(C)=C2C |
| InChI | InChI=1S/C32H50O3/c1-8-9-22-32-28(6)26(4)18-19-29(32)20-23-31(7,35-32)21-12-16-25(3)14-10-13-24(2)15-11-17-27(5)30(33)34/h14-15,18,27H,8-13,16-17,20-23H2,1-7H3,(H,33,34)/p-1/b24-15+,25-14+ |
| InChIKey | QQQFBYQEJIYLCV-IUEJRMLYSA-M |
| XLogP | 7.93 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.74 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|