C36H57O3- — CID 59271440
(5E,10E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-8a-octyl-3,4-dihydrochromen-2-yl)trideca-5,10-dienoate (PubChem CID 59271440) has the molecular formula C36H57O3- and a molecular weight of 537.85 g/mol. Its IUPAC name is (5E,10E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-8a-octyl-3,4-dihydrochromen-2-yl)trideca-5,10-dienoate.
| Compound Name | (5E,10E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-8a-octyl-3,4-dihydrochromen-2-yl)trideca-5,10-dienoate |
|---|---|
| PubChem CID | 59271440 |
| Molecular Formula | C36H57O3- |
| Molecular Weight | 537.85 g/mol |
| Exact Mass | 537.43 |
| IUPAC Name | (5E,10E)-2,6,10-trimethyl-13-(2,7,8-trimethyl-8a-octyl-3,4-dihydrochromen-2-yl)trideca-5,10-dienoate |
| SMILES | CCCCCCCCC12OC(C)(CC/C=C(\C)CCC/C(C)=C/CCC(C)C(=O)[O-])CCC1=C=CC(C)=C2C |
| InChI | InChI=1S/C36H58O3/c1-8-9-10-11-12-13-26-36-32(6)30(4)22-23-33(36)24-27-35(7,39-36)25-16-20-29(3)18-14-17-28(2)19-15-21-31(5)34(37)38/h19-20,22,31H,8-18,21,24-27H2,1-7H3,(H,37,38)/p-1/b28-19+,29-20+ |
| InChIKey | INVOFWHAUJRWII-JUWMQZRYSA-M |
| XLogP | 9.49 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.85 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|