C26H41BClNO5 — CID 59273097
cyclopentyl (2S)-2-[3-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propylamino]-4-methylpentanoate (PubChem CID 59273097) has the molecular formula C26H41BClNO5 and a molecular weight of 493.88 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[3-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propylamino]-4-methylpentanoate.
| Compound Name | cyclopentyl (2S)-2-[3-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 59273097 |
| Molecular Formula | C26H41BClNO5 |
| Molecular Weight | 493.88 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | cyclopentyl (2S)-2-[3-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propylamino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NCCCOc1ccc(B2OC(C)(C)C(C)(C)O2)c(Cl)c1)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C26H41BClNO5/c1-18(2)16-23(24(30)32-19-10-7-8-11-19)29-14-9-15-31-20-12-13-21(22(28)17-20)27-33-25(3,4)26(5,6)34-27/h12-13,17-19,23,29H,7-11,14-16H2,1-6H3/t23-/m0/s1 |
| InChIKey | FIMRHNCTICJWPY-QHCPKHFHSA-N |
| XLogP | 4.90 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.88 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|