C10H12ClNO — CID 59274116
5-chloro-6-methoxy-2-methyl-1,3-dihydroisoindole (PubChem CID 59274116) has the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. Its IUPAC name is 5-chloro-6-methoxy-2-methyl-1,3-dihydroisoindole.
| Compound Name | 5-chloro-6-methoxy-2-methyl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 59274116 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 5-chloro-6-methoxy-2-methyl-1,3-dihydroisoindole |
| SMILES | COc1cc2c(cc1Cl)CN(C)C2 |
| InChI | InChI=1S/C10H12ClNO/c1-12-5-7-3-9(11)10(13-2)4-8(7)6-12/h3-4H,5-6H2,1-2H3 |
| InChIKey | ZLMISYGINITNAE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |