C13H18Cl2N2O2S2 — CID 88532792
1,4-dichloro-2,5-dimethoxybenzene;3,5-dimethyl-1,3,5-thiadiazinane-2-thione (PubChem CID 88532792) has the molecular formula C13H18Cl2N2O2S2 and a molecular weight of 369.34 g/mol. Its IUPAC name is 1,4-dichloro-2,5-dimethoxybenzene;3,5-dimethyl-1,3,5-thiadiazinane-2-thione.
| Compound Name | 1,4-dichloro-2,5-dimethoxybenzene;3,5-dimethyl-1,3,5-thiadiazinane-2-thione |
|---|---|
| PubChem CID | 88532792 |
| Molecular Formula | C13H18Cl2N2O2S2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 1,4-dichloro-2,5-dimethoxybenzene;3,5-dimethyl-1,3,5-thiadiazinane-2-thione |
| SMILES | CN1CSC(=S)N(C)C1.COc1cc(Cl)c(OC)cc1Cl |
| InChI | InChI=1S/C8H8Cl2O2.C5H10N2S2/c1-11-7-3-6(10)8(12-2)4-5(7)9;1-6-3-7(2)5(8)9-4-6/h3-4H,1-2H3;3-4H2,1-2H3 |
| InChIKey | UPCWPPJSCVOAPN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|