C17H19N3Y-2 — CID 59277509
3-ethenyl-2-(4-methylpiperazin-1-yl)-4,5-dihydro-1-benzazepin-4-ide;yttrium (PubChem CID 59277509) has the molecular formula C17H19N3Y-2 and a molecular weight of 354.27 g/mol. Its IUPAC name is 3-ethenyl-2-(4-methylpiperazin-1-yl)-4,5-dihydro-1-benzazepin-4-ide;yttrium.
| Compound Name | 3-ethenyl-2-(4-methylpiperazin-1-yl)-4,5-dihydro-1-benzazepin-4-ide;yttrium |
|---|---|
| PubChem CID | 59277509 |
| Molecular Formula | C17H19N3Y-2 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 3-ethenyl-2-(4-methylpiperazin-1-yl)-4,5-dihydro-1-benzazepin-4-ide;yttrium |
| SMILES | [H]/[C-]=C/C1=[C-]Cc2ccccc2N=C1N1CCN(C)CC1.[Y] |
| InChI | InChI=1S/C17H19N3.Y/c1-3-14-8-9-15-6-4-5-7-16(15)18-17(14)20-12-10-19(2)11-13-20;/h1,3-7H,9-13H2,2H3;/q-2; |
| InChIKey | VUTLHCMSNMSKMZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|