C19H16FN3O2 — CID 59281268
6-[1-ethyl-5-(4-fluorophenyl)pyrazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 59281268) has the molecular formula C19H16FN3O2 and a molecular weight of 337.35 g/mol. Its IUPAC name is 6-[1-ethyl-5-(4-fluorophenyl)pyrazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[1-ethyl-5-(4-fluorophenyl)pyrazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 59281268 |
| Molecular Formula | C19H16FN3O2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 6-[1-ethyl-5-(4-fluorophenyl)pyrazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CCn1ncc(-c2ccc3c(c2)NC(=O)CO3)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16FN3O2/c1-2-23-19(12-3-6-14(20)7-4-12)15(10-21-23)13-5-8-17-16(9-13)22-18(24)11-25-17/h3-10H,2,11H2,1H3,(H,22,24) |
| InChIKey | MGAGCLLZRPQSGW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |