C22H22FN3O3S — CID 59281314
6-[5-(4-fluorophenyl)-1-[2-(2-hydroxyethylsulfanyl)ethyl]-3-methylpyrazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 59281314) has the molecular formula C22H22FN3O3S and a molecular weight of 427.50 g/mol. Its IUPAC name is 6-[5-(4-fluorophenyl)-1-[2-(2-hydroxyethylsulfanyl)ethyl]-3-methylpyrazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[5-(4-fluorophenyl)-1-[2-(2-hydroxyethylsulfanyl)ethyl]-3-methylpyrazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 59281314 |
| Molecular Formula | C22H22FN3O3S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 6-[5-(4-fluorophenyl)-1-[2-(2-hydroxyethylsulfanyl)ethyl]-3-methylpyrazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1nn(CCSCCO)c(-c2ccc(F)cc2)c1-c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C22H22FN3O3S/c1-14-21(16-4-7-19-18(12-16)24-20(28)13-29-19)22(15-2-5-17(23)6-3-15)26(25-14)8-10-30-11-9-27/h2-7,12,27H,8-11,13H2,1H3,(H,24,28) |
| InChIKey | BHQHUIBDQYXQAH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|