C21H21FN4O2S — CID 89084425
6-[5-(4-fluorophenyl)-3-methyl-1-[2-(methylaminosulfanyl)ethyl]pyrazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 89084425) has the molecular formula C21H21FN4O2S and a molecular weight of 412.49 g/mol. Its IUPAC name is 6-[5-(4-fluorophenyl)-3-methyl-1-[2-(methylaminosulfanyl)ethyl]pyrazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[5-(4-fluorophenyl)-3-methyl-1-[2-(methylaminosulfanyl)ethyl]pyrazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 89084425 |
| Molecular Formula | C21H21FN4O2S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 6-[5-(4-fluorophenyl)-3-methyl-1-[2-(methylaminosulfanyl)ethyl]pyrazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CNSCCn1nc(C)c(-c2ccc3c(c2)NC(=O)CO3)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN4O2S/c1-13-20(15-5-8-18-17(11-15)24-19(27)12-28-18)21(14-3-6-16(22)7-4-14)26(25-13)9-10-29-23-2/h3-8,11,23H,9-10,12H2,1-2H3,(H,24,27) |
| InChIKey | XHVPFJKMLARJMN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|