C38H42O4 — CID 59281821
[4-[4-(4-ethylbenzoyl)oxy-2,3,5,6-tetramethylphenyl]-2,3,5,6-tetramethylphenyl] 4-ethylbenzoate (PubChem CID 59281821) has the molecular formula C38H42O4 and a molecular weight of 562.75 g/mol. Its IUPAC name is [4-[4-(4-ethylbenzoyl)oxy-2,3,5,6-tetramethylphenyl]-2,3,5,6-tetramethylphenyl] 4-ethylbenzoate.
| Compound Name | [4-[4-(4-ethylbenzoyl)oxy-2,3,5,6-tetramethylphenyl]-2,3,5,6-tetramethylphenyl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 59281821 |
| Molecular Formula | C38H42O4 |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | [4-[4-(4-ethylbenzoyl)oxy-2,3,5,6-tetramethylphenyl]-2,3,5,6-tetramethylphenyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)Oc2c(C)c(C)c(-c3c(C)c(C)c(OC(=O)c4ccc(CC)cc4)c(C)c3C)c(C)c2C)cc1 |
| InChI | InChI=1S/C38H42O4/c1-11-29-13-17-31(18-14-29)37(39)41-35-25(7)21(3)33(22(4)26(35)8)34-23(5)27(9)36(28(10)24(34)6)42-38(40)32-19-15-30(12-2)16-20-32/h13-20H,11-12H2,1-10H3 |
| InChIKey | NTHQFFMXLFIHCF-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|