C9H9NO2 — CID 59284003
5,7-dimethylfuro[3,2-c]pyridin-6-one (PubChem CID 59284003) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 5,7-dimethylfuro[3,2-c]pyridin-6-one.
| Compound Name | 5,7-dimethylfuro[3,2-c]pyridin-6-one |
|---|---|
| PubChem CID | 59284003 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 5,7-dimethylfuro[3,2-c]pyridin-6-one |
| SMILES | Cc1c(=O)n(C)cc2ccoc12 |
| InChI | InChI=1S/C9H9NO2/c1-6-8-7(3-4-12-8)5-10(2)9(6)11/h3-5H,1-2H3 |
| InChIKey | DXBGDQQRIHDFOT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |