C9H13NO2 — CID 123400251
4-methoxy-1,3,5-trimethylpyridin-2-one (PubChem CID 123400251) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 4-methoxy-1,3,5-trimethylpyridin-2-one.
| Compound Name | 4-methoxy-1,3,5-trimethylpyridin-2-one |
|---|---|
| PubChem CID | 123400251 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 4-methoxy-1,3,5-trimethylpyridin-2-one |
| SMILES | COc1c(C)cn(C)c(=O)c1C |
| InChI | InChI=1S/C9H13NO2/c1-6-5-10(3)9(11)7(2)8(6)12-4/h5H,1-4H3 |
| InChIKey | RFRPHIMTOSGAEX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |