C10H14OS — CID 172564996
3-methoxy-2,4,6-trimethylbenzenethiol (PubChem CID 172564996) has the molecular formula C10H14OS and a molecular weight of 182.29 g/mol. Its IUPAC name is 3-methoxy-2,4,6-trimethylbenzenethiol.
| Compound Name | 3-methoxy-2,4,6-trimethylbenzenethiol |
|---|---|
| PubChem CID | 172564996 |
| Molecular Formula | C10H14OS |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 3-methoxy-2,4,6-trimethylbenzenethiol |
| SMILES | COc1c(C)cc(C)c(S)c1C |
| InChI | InChI=1S/C10H14OS/c1-6-5-7(2)10(12)8(3)9(6)11-4/h5,12H,1-4H3 |
| InChIKey | GEKUJDUIIBIBKK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|