C12H12S — CID 130390720
2,4-dimethylnaphthalene-1-thiol (PubChem CID 130390720) has the molecular formula C12H12S and a molecular weight of 188.29 g/mol. Its IUPAC name is 2,4-dimethylnaphthalene-1-thiol.
| Compound Name | 2,4-dimethylnaphthalene-1-thiol |
|---|---|
| PubChem CID | 130390720 |
| Molecular Formula | C12H12S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 2,4-dimethylnaphthalene-1-thiol |
| SMILES | Cc1cc(C)c2ccccc2c1S |
| InChI | InChI=1S/C12H12S/c1-8-7-9(2)12(13)11-6-4-3-5-10(8)11/h3-7,13H,1-2H3 |
| InChIKey | NRTQTZRKISZKJF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|