C15H12S2 — CID 171785822
2-methylphenanthrene-9,10-dithiol (PubChem CID 171785822) has the molecular formula C15H12S2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-methylphenanthrene-9,10-dithiol.
| Compound Name | 2-methylphenanthrene-9,10-dithiol |
|---|---|
| PubChem CID | 171785822 |
| Molecular Formula | C15H12S2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-methylphenanthrene-9,10-dithiol |
| SMILES | Cc1ccc2c(c1)c(S)c(S)c1ccccc12 |
| InChI | InChI=1S/C15H12S2/c1-9-6-7-11-10-4-2-3-5-12(10)14(16)15(17)13(11)8-9/h2-8,16-17H,1H3 |
| InChIKey | IQEJXXFJMRPVLV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|