C8H11NO2 — CID 15144235
4-methoxy-1,3-dimethylpyridin-2-one (PubChem CID 15144235) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 4-methoxy-1,3-dimethylpyridin-2-one.
| Compound Name | 4-methoxy-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 15144235 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 4-methoxy-1,3-dimethylpyridin-2-one |
| SMILES | COc1ccn(C)c(=O)c1C |
| InChI | InChI=1S/C8H11NO2/c1-6-7(11-3)4-5-9(2)8(6)10/h4-5H,1-3H3 |
| InChIKey | UOWZMFVPAMTEGJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |