C22H32N4O6 — CID 59284432
5-[(Z)-[6-[(E)-6-[(E)-3-oxobutan-2-ylideneamino]oxyhexoxyiminomethyl]-2-pyridinyl]methylideneamino]oxypentanoic acid (PubChem CID 59284432) has the molecular formula C22H32N4O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is 5-[(Z)-[6-[(E)-6-[(E)-3-oxobutan-2-ylideneamino]oxyhexoxyiminomethyl]-2-pyridinyl]methylideneamino]oxypentanoic acid.
| Compound Name | 5-[(Z)-[6-[(E)-6-[(E)-3-oxobutan-2-ylideneamino]oxyhexoxyiminomethyl]-2-pyridinyl]methylideneamino]oxypentanoic acid |
|---|---|
| PubChem CID | 59284432 |
| Molecular Formula | C22H32N4O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 5-[(Z)-[6-[(E)-6-[(E)-3-oxobutan-2-ylideneamino]oxyhexoxyiminomethyl]-2-pyridinyl]methylideneamino]oxypentanoic acid |
| SMILES | CC(=O)/C(C)=N/OCCCCCCO/N=C/c1cccc(/C=N\OCCCCC(=O)O)n1 |
| InChI | InChI=1S/C22H32N4O6/c1-18(19(2)27)26-32-15-7-4-3-6-13-30-23-16-20-10-9-11-21(25-20)17-24-31-14-8-5-12-22(28)29/h9-11,16-17H,3-8,12-15H2,1-2H3,(H,28,29)/b23-16+,24-17-,26-18+ |
| InChIKey | WNEYHVCYOBIWQO-ITVNPHAMSA-N |
| XLogP | 3.58 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|