C12H13BrFNO3 — CID 75689962
4-[1-(3-bromo-2-fluorophenyl)ethylideneamino]oxybutanoic acid (PubChem CID 75689962) has the molecular formula C12H13BrFNO3 and a molecular weight of 318.14 g/mol. Its IUPAC name is 4-[1-(3-bromo-2-fluorophenyl)ethylideneamino]oxybutanoic acid.
| Compound Name | 4-[1-(3-bromo-2-fluorophenyl)ethylideneamino]oxybutanoic acid |
|---|---|
| PubChem CID | 75689962 |
| Molecular Formula | C12H13BrFNO3 |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 4-[1-(3-bromo-2-fluorophenyl)ethylideneamino]oxybutanoic acid |
| SMILES | CC(=NOCCCC(=O)O)c1cccc(Br)c1F |
| InChI | InChI=1S/C12H13BrFNO3/c1-8(15-18-7-3-6-11(16)17)9-4-2-5-10(13)12(9)14/h2,4-5H,3,6-7H2,1H3,(H,16,17) |
| InChIKey | UWFDNAIYAOCWOX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|