C10H9BrF3NO — CID 53484347
(E)-1-(3-bromo-2-fluorophenyl)-N-(2,2-difluoroethoxy)ethanimine (PubChem CID 53484347) has the molecular formula C10H9BrF3NO and a molecular weight of 296.09 g/mol. Its IUPAC name is (E)-1-(3-bromo-2-fluorophenyl)-N-(2,2-difluoroethoxy)ethanimine.
| Compound Name | (E)-1-(3-bromo-2-fluorophenyl)-N-(2,2-difluoroethoxy)ethanimine |
|---|---|
| PubChem CID | 53484347 |
| Molecular Formula | C10H9BrF3NO |
| Molecular Weight | 296.09 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | (E)-1-(3-bromo-2-fluorophenyl)-N-(2,2-difluoroethoxy)ethanimine |
| SMILES | C/C(=N\OCC(F)F)c1cccc(Br)c1F |
| InChI | InChI=1S/C10H9BrF3NO/c1-6(15-16-5-9(12)13)7-3-2-4-8(11)10(7)14/h2-4,9H,5H2,1H3/b15-6+ |
| InChIKey | KONLQQBTGABFGV-GIDUJCDVSA-N |
| XLogP | 3.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.09 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|