C25H32O — CID 59288380
1-[4-(4-but-3-enylcyclohexyl)phenyl]-4-methoxy-2,3-dimethylbenzene (PubChem CID 59288380) has the molecular formula C25H32O and a molecular weight of 348.53 g/mol. Its IUPAC name is 1-[4-(4-but-3-enylcyclohexyl)phenyl]-4-methoxy-2,3-dimethylbenzene.
| Compound Name | 1-[4-(4-but-3-enylcyclohexyl)phenyl]-4-methoxy-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 59288380 |
| Molecular Formula | C25H32O |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 1-[4-(4-but-3-enylcyclohexyl)phenyl]-4-methoxy-2,3-dimethylbenzene |
| SMILES | C=CCCC1CCC(c2ccc(-c3ccc(OC)c(C)c3C)cc2)CC1 |
| InChI | InChI=1S/C25H32O/c1-5-6-7-20-8-10-21(11-9-20)22-12-14-23(15-13-22)24-16-17-25(26-4)19(3)18(24)2/h5,12-17,20-21H,1,6-11H2,2-4H3 |
| InChIKey | NAKNRDBCJFKZLR-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|