C28H15AlCl6N3O3+ — CID 59288628
(5,7-dichloro-1-methylquinolin-1-ium-8-yl)oxy-bis[(5,7-dichloroquinolin-8-yl)oxy]alumane (PubChem CID 59288628) has the molecular formula C28H15AlCl6N3O3+ and a molecular weight of 681.15 g/mol. Its IUPAC name is (5,7-dichloro-1-methylquinolin-1-ium-8-yl)oxy-bis[(5,7-dichloroquinolin-8-yl)oxy]alumane.
| Compound Name | (5,7-dichloro-1-methylquinolin-1-ium-8-yl)oxy-bis[(5,7-dichloroquinolin-8-yl)oxy]alumane |
|---|---|
| PubChem CID | 59288628 |
| Molecular Formula | C28H15AlCl6N3O3+ |
| Molecular Weight | 681.15 g/mol |
| Exact Mass | 677.91 |
| IUPAC Name | (5,7-dichloro-1-methylquinolin-1-ium-8-yl)oxy-bis[(5,7-dichloroquinolin-8-yl)oxy]alumane |
| SMILES | C[n+]1cccc2c(Cl)cc(Cl)c(O[Al](Oc3c(Cl)cc(Cl)c4cccnc34)Oc3c(Cl)cc(Cl)c4cccnc34)c21 |
| InChI | InChI=1S/C10H7Cl2NO.2C9H5Cl2NO.Al/c1-13-4-2-3-6-7(11)5-8(12)10(14)9(6)13;2*10-6-4-7(11)9(13)8-5(6)2-1-3-12-8;/h2-5H,1H3;2*1-4,13H;/q;;;+3/p-2 |
| InChIKey | UUTXELHAFICDKJ-UHFFFAOYSA-L |
| XLogP | 9.20 |
| TPSA | 57.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.15 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|